A catalyst don’t appear in the overall stoichiometry of the reaction it catalyzes, Safety of N1,N2-Diphenylethane-1,2-diamine, but it must appear in at least one of the elementary reactions in the mechanism for the catalyzed reaction. 150-61-8, Name is N1,N2-Diphenylethane-1,2-diamine, molecular formula is C14H16N2. In a Article, authors is Jung, Ok-Sang，once mentioned of 150-61-8
New itaconic estertin(IV) complexes CH3OOCCH2CH(COOCH3)CH2Sn(L)Cl2 (1, L = S2CNMe2; 2, L = (Pz)3BH; 3, L = OH) were synthesized and characterized by means of X-ray crystallography and spectroscopy.The crystal structures of 1 (P21/n; a = 7.830(1), b = 13.262(1), c = 16.958(2) Angstroem, beta = 91.269(9) deg; Z = 4, R = 0.043) and 3 (P21/n; a = 11.611(2), b = 12.301(2), c = 12.435(2) Angstroem, beta = 101.02(1) deg; Z = 4; R = 0.043) show that each tin atom approximates to octahedral geometry via an intramolecular carbonyl-to-tin coordination in addition to either chelation of the dithiocarbamate (for 1) or hydroxobridging (for 3).The reaction of 1 or 3 with sodium sulfide gives CH3OOCCH2CH(COOCH3)CH2Sn(L)S (4, L = S2CNMe2; 5, L = OH), whereas the same reaction of 2 does not give the analogous chemical product but instead allows dissociation of the trispyrazolylborate ligand.
Enzymes are biological catalysts that produce large increases in reaction rates and tend to be specific for certain reactants and products. I hope my blog about is helpful to your research. Safety of N1,N2-Diphenylethane-1,2-diamine
Reference：
Metal catalyst and ligand design,
Ligand Template Strategies for Catalyst Encapsulation – NCBI